C22H32N4O2 — CID 119620972
1-(1,3-benzoxazol-2-yl)-N-[2-(cycloheptylamino)ethyl]piperidine-4-carboxamide (PubChem CID 119620972) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-[2-(cycloheptylamino)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-[2-(cycloheptylamino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119620972 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-[2-(cycloheptylamino)ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCNC1CCCCCC1)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C22H32N4O2/c27-21(24-14-13-23-18-7-3-1-2-4-8-18)17-11-15-26(16-12-17)22-25-19-9-5-6-10-20(19)28-22/h5-6,9-10,17-18,23H,1-4,7-8,11-16H2,(H,24,27) |
| InChIKey | HIUSPBISGDFVNB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|