C19H18Cl2N4O3S — CID 135877578
2-[[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-3H-quinazolin-4-one (PubChem CID 135877578) has the molecular formula C19H18Cl2N4O3S and a molecular weight of 453.35 g/mol. Its IUPAC name is 2-[[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135877578 |
| Molecular Formula | C19H18Cl2N4O3S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 2-[[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CN2CCN(S(=O)(=O)c3cc(Cl)ccc3Cl)CC2)nc2ccccc12 |
| InChI | InChI=1S/C19H18Cl2N4O3S/c20-13-5-6-15(21)17(11-13)29(27,28)25-9-7-24(8-10-25)12-18-22-16-4-2-1-3-14(16)19(26)23-18/h1-6,11H,7-10,12H2,(H,22,23,26) |
| InChIKey | ANVHYEZSBWIXFD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |