C20H21FN4O3S — CID 135799534
2-[[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-3H-quinazolin-4-one (PubChem CID 135799534) has the molecular formula C20H21FN4O3S and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135799534 |
| Molecular Formula | C20H21FN4O3S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CN2CCCN(S(=O)(=O)c3ccc(F)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C20H21FN4O3S/c21-15-6-8-16(9-7-15)29(27,28)25-11-3-10-24(12-13-25)14-19-22-18-5-2-1-4-17(18)20(26)23-19/h1-2,4-9H,3,10-14H2,(H,22,23,26) |
| InChIKey | GGLVBQJYXUKMKX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |