C18H17ClN4O3 — CID 135783142
6-chloro-2-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-3H-quinazolin-4-one (PubChem CID 135783142) has the molecular formula C18H17ClN4O3 and a molecular weight of 372.81 g/mol. Its IUPAC name is 6-chloro-2-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-3H-quinazolin-4-one.
| Compound Name | 6-chloro-2-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135783142 |
| Molecular Formula | C18H17ClN4O3 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 6-chloro-2-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-3H-quinazolin-4-one |
| SMILES | O=C(c1ccco1)N1CCN(Cc2nc3ccc(Cl)cc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C18H17ClN4O3/c19-12-3-4-14-13(10-12)17(24)21-16(20-14)11-22-5-7-23(8-6-22)18(25)15-2-1-9-26-15/h1-4,9-10H,5-8,11H2,(H,20,21,24) |
| InChIKey | QGVAZCDPTVRQJZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |