About 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one
6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one (PubChem CID 136563185) has the molecular formula C17H17ClN4O2
and a molecular weight of 344.80 g/mol. Its IUPAC name is 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one |
| PubChem CID | 136563185 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CN2CCC(c3ncco3)CC2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C17H17ClN4O2/c18-12-1-2-14-13(9-12)16(23)21-15(20-14)10-22-6-3-11(4-7-22)17-19-5-8-24-17/h1-2,5,8-9,11H,3-4,6-7,10H2,(H,20,21,23) |
| InChIKey | LOCADKDPOUUKLH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one?
The IUPAC name of 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one (CID 136563185) is 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one.
What is the SMILES notation for 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one?
The canonical SMILES for 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one is O=c1[nH]c(CN2CCC(c3ncco3)CC2)nc2ccc(Cl)cc12.
What is the InChIKey of 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one?
The InChIKey is LOCADKDPOUUKLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN4O2/c18-12-1-2-14-13(9-12)16(23)21-15(20-14)10-22-6-3-11(4-7-22)17-19-5-8-24-17/h1-2,5,8-9,11H,3-4,6-7,10H2,(H,20,21,23).
What are the key properties of 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one?
6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one has a molecular weight of 344.80 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-[[4-(1,3-oxazol-2-yl)piperidin-1-yl]methyl]-3H-quinazolin-4-one is sourced from PubChem (CID 136563185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).