C22H17ClN4O4 — CID 3617574
2-chloro-8-[4-(furan-2-carbonyl)piperazine-1-carbonyl]pyrido[2,1-b]quinazolin-11-one (PubChem CID 3617574) has the molecular formula C22H17ClN4O4 and a molecular weight of 436.86 g/mol. Its IUPAC name is 2-chloro-8-[4-(furan-2-carbonyl)piperazine-1-carbonyl]pyrido[2,1-b]quinazolin-11-one.
| Compound Name | 2-chloro-8-[4-(furan-2-carbonyl)piperazine-1-carbonyl]pyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 3617574 |
| Molecular Formula | C22H17ClN4O4 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-chloro-8-[4-(furan-2-carbonyl)piperazine-1-carbonyl]pyrido[2,1-b]quinazolin-11-one |
| SMILES | O=C(c1ccc2nc3ccc(Cl)cc3c(=O)n2c1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C22H17ClN4O4/c23-15-4-5-17-16(12-15)21(29)27-13-14(3-6-19(27)24-17)20(28)25-7-9-26(10-8-25)22(30)18-2-1-11-31-18/h1-6,11-13H,7-10H2 |
| InChIKey | HJDDOLSBQFDKPF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|