C17H14ClN3O3 — CID 5215714
3-chloro-8-(morpholine-4-carbonyl)pyrido[2,1-b]quinazolin-11-one (PubChem CID 5215714) has the molecular formula C17H14ClN3O3 and a molecular weight of 343.77 g/mol. Its IUPAC name is 3-chloro-8-(morpholine-4-carbonyl)pyrido[2,1-b]quinazolin-11-one.
| Compound Name | 3-chloro-8-(morpholine-4-carbonyl)pyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 5215714 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 3-chloro-8-(morpholine-4-carbonyl)pyrido[2,1-b]quinazolin-11-one |
| SMILES | O=C(c1ccc2nc3cc(Cl)ccc3c(=O)n2c1)N1CCOCC1 |
| InChI | InChI=1S/C17H14ClN3O3/c18-12-2-3-13-14(9-12)19-15-4-1-11(10-21(15)17(13)23)16(22)20-5-7-24-8-6-20/h1-4,9-10H,5-8H2 |
| InChIKey | AZXFOXFMFDGUSR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|