C19H18ClN3O2 — CID 5130466
3-chloro-N-cyclohexyl-11-oxopyrido[2,1-b]quinazoline-8-carboxamide (PubChem CID 5130466) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 3-chloro-N-cyclohexyl-11-oxopyrido[2,1-b]quinazoline-8-carboxamide.
| Compound Name | 3-chloro-N-cyclohexyl-11-oxopyrido[2,1-b]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 5130466 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 3-chloro-N-cyclohexyl-11-oxopyrido[2,1-b]quinazoline-8-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccc2nc3cc(Cl)ccc3c(=O)n2c1 |
| InChI | InChI=1S/C19H18ClN3O2/c20-13-7-8-15-16(10-13)22-17-9-6-12(11-23(17)19(15)25)18(24)21-14-4-2-1-3-5-14/h6-11,14H,1-5H2,(H,21,24) |
| InChIKey | QIULNELXBWYHIX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|