C20H26ClN3O2S — CID 7428000
(2R)-2-(7-chloro-4-oxo-3-propan-2-ylquinazolin-2-yl)sulfanyl-N-cyclohexylpropanamide (PubChem CID 7428000) has the molecular formula C20H26ClN3O2S and a molecular weight of 407.97 g/mol. Its IUPAC name is (2R)-2-(7-chloro-4-oxo-3-propan-2-ylquinazolin-2-yl)sulfanyl-N-cyclohexylpropanamide.
| Compound Name | (2R)-2-(7-chloro-4-oxo-3-propan-2-ylquinazolin-2-yl)sulfanyl-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 7428000 |
| Molecular Formula | C20H26ClN3O2S |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (2R)-2-(7-chloro-4-oxo-3-propan-2-ylquinazolin-2-yl)sulfanyl-N-cyclohexylpropanamide |
| SMILES | CC(C)n1c(S[C@H](C)C(=O)NC2CCCCC2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H26ClN3O2S/c1-12(2)24-19(26)16-10-9-14(21)11-17(16)23-20(24)27-13(3)18(25)22-15-7-5-4-6-8-15/h9-13,15H,4-8H2,1-3H3,(H,22,25)/t13-/m1/s1 |
| InChIKey | HDXYEOJXVKFIHX-CYBMUJFWSA-N |
| XLogP | 4.56 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |