C23H24ClN3O2S — CID 42980062
2-[7-chloro-3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-cyclopentylpropanamide (PubChem CID 42980062) has the molecular formula C23H24ClN3O2S and a molecular weight of 441.98 g/mol. Its IUPAC name is 2-[7-chloro-3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-cyclopentylpropanamide.
| Compound Name | 2-[7-chloro-3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 42980062 |
| Molecular Formula | C23H24ClN3O2S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-[7-chloro-3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-cyclopentylpropanamide |
| SMILES | Cc1ccccc1-n1c(SC(C)C(=O)NC2CCCC2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C23H24ClN3O2S/c1-14-7-3-6-10-20(14)27-22(29)18-12-11-16(24)13-19(18)26-23(27)30-15(2)21(28)25-17-8-4-5-9-17/h3,6-7,10-13,15,17H,4-5,8-9H2,1-2H3,(H,25,28) |
| InChIKey | MAIUDKQNQGYGIJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |