C18H20ClN5 — CID 75510403
6-chloro-2-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1H-benzimidazole (PubChem CID 75510403) has the molecular formula C18H20ClN5 and a molecular weight of 341.85 g/mol. Its IUPAC name is 6-chloro-2-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1H-benzimidazole.
| Compound Name | 6-chloro-2-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 75510403 |
| Molecular Formula | C18H20ClN5 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 6-chloro-2-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1H-benzimidazole |
| SMILES | Clc1ccc2nc(CN3CCN(Cc4ccccn4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C18H20ClN5/c19-14-4-5-16-17(11-14)22-18(21-16)13-24-9-7-23(8-10-24)12-15-3-1-2-6-20-15/h1-6,11H,7-10,12-13H2,(H,21,22) |
| InChIKey | KARXXPDJPBDSMG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |