C21H27N3 — CID 142062604
2-[(4-benzylpiperidin-1-yl)methyl]-1H-benzimidazole;methane (PubChem CID 142062604) has the molecular formula C21H27N3 and a molecular weight of 321.47 g/mol. Its IUPAC name is 2-[(4-benzylpiperidin-1-yl)methyl]-1H-benzimidazole;methane.
| Compound Name | 2-[(4-benzylpiperidin-1-yl)methyl]-1H-benzimidazole;methane |
|---|---|
| PubChem CID | 142062604 |
| Molecular Formula | C21H27N3 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 2-[(4-benzylpiperidin-1-yl)methyl]-1H-benzimidazole;methane |
| SMILES | C.c1ccc(CC2CCN(Cc3nc4ccccc4[nH]3)CC2)cc1 |
| InChI | InChI=1S/C20H23N3.CH4/c1-2-6-16(7-3-1)14-17-10-12-23(13-11-17)15-20-21-18-8-4-5-9-19(18)22-20;/h1-9,17H,10-15H2,(H,21,22);1H4 |
| InChIKey | ZNYZJHIZFOHBOR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |