C17H24N4 — CID 63595893
1-[1-[(1-phenylpyrazol-3-yl)methyl]piperidin-4-yl]ethanamine (PubChem CID 63595893) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 1-[1-[(1-phenylpyrazol-3-yl)methyl]piperidin-4-yl]ethanamine.
| Compound Name | 1-[1-[(1-phenylpyrazol-3-yl)methyl]piperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 63595893 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 1-[1-[(1-phenylpyrazol-3-yl)methyl]piperidin-4-yl]ethanamine |
| SMILES | CC(N)C1CCN(Cc2ccn(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C17H24N4/c1-14(18)15-7-10-20(11-8-15)13-16-9-12-21(19-16)17-5-3-2-4-6-17/h2-6,9,12,14-15H,7-8,10-11,13,18H2,1H3 |
| InChIKey | FNACBGLCWLSZDX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |