C17H22N4O — CID 126788559
1-ethyl-4-[(1-phenylpyrazol-3-yl)methyl]-1,4-diazepan-2-one (PubChem CID 126788559) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-ethyl-4-[(1-phenylpyrazol-3-yl)methyl]-1,4-diazepan-2-one.
| Compound Name | 1-ethyl-4-[(1-phenylpyrazol-3-yl)methyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 126788559 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-ethyl-4-[(1-phenylpyrazol-3-yl)methyl]-1,4-diazepan-2-one |
| SMILES | CCN1CCCN(Cc2ccn(-c3ccccc3)n2)CC1=O |
| InChI | InChI=1S/C17H22N4O/c1-2-20-11-6-10-19(14-17(20)22)13-15-9-12-21(18-15)16-7-4-3-5-8-16/h3-5,7-9,12H,2,6,10-11,13-14H2,1H3 |
| InChIKey | LRLIBNXXLOSSGA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |