C19H24N6O — CID 138029905
4-methoxy-1-[[1-[(1-phenylpyrazol-3-yl)methyl]triazol-4-yl]methyl]piperidine (PubChem CID 138029905) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 4-methoxy-1-[[1-[(1-phenylpyrazol-3-yl)methyl]triazol-4-yl]methyl]piperidine.
| Compound Name | 4-methoxy-1-[[1-[(1-phenylpyrazol-3-yl)methyl]triazol-4-yl]methyl]piperidine |
|---|---|
| PubChem CID | 138029905 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 4-methoxy-1-[[1-[(1-phenylpyrazol-3-yl)methyl]triazol-4-yl]methyl]piperidine |
| SMILES | COC1CCN(Cc2cn(Cc3ccn(-c4ccccc4)n3)nn2)CC1 |
| InChI | InChI=1S/C19H24N6O/c1-26-19-8-10-23(11-9-19)13-17-15-24(22-20-17)14-16-7-12-25(21-16)18-5-3-2-4-6-18/h2-7,12,15,19H,8-11,13-14H2,1H3 |
| InChIKey | BPIYOZDGXGJZMM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |