About 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine
1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine (PubChem CID 167916388) has the molecular formula C18H21F2N7
and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine.
Molecular Properties
| Compound Name | 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine |
| PubChem CID | 167916388 |
| Molecular Formula | C18H21F2N7 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine |
| SMILES | NC1CCCN(Cc2cn(Cc3ccn(-c4c(F)cccc4F)n3)nn2)C1 |
| InChI | InChI=1S/C18H21F2N7/c19-16-4-1-5-17(20)18(16)27-8-6-14(23-27)11-26-12-15(22-24-26)10-25-7-2-3-13(21)9-25/h1,4-6,8,12-13H,2-3,7,9-11,21H2 |
| InChIKey | YGYXKJUKOCYVNM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 77.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine?
The IUPAC name of 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine (CID 167916388) is 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine.
What is the SMILES notation for 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine?
The canonical SMILES for 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine is NC1CCCN(Cc2cn(Cc3ccn(-c4c(F)cccc4F)n3)nn2)C1.
What is the InChIKey of 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine?
The InChIKey is YGYXKJUKOCYVNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21F2N7/c19-16-4-1-5-17(20)18(16)27-8-6-14(23-27)11-26-12-15(22-24-26)10-25-7-2-3-13(21)9-25/h1,4-6,8,12-13H,2-3,7,9-11,21H2.
What are the key properties of 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine?
1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine has a molecular weight of 373.41 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]triazol-4-yl]methyl]piperidin-3-amine is sourced from PubChem (CID 167916388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).