C16H24ClN7O — CID 119917289
N-(2-aminoethyl)-1-[(1-phenyltetrazol-5-yl)methyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119917289) has the molecular formula C16H24ClN7O and a molecular weight of 365.87 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[(1-phenyltetrazol-5-yl)methyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-[(1-phenyltetrazol-5-yl)methyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119917289 |
| Molecular Formula | C16H24ClN7O |
| Molecular Weight | 365.87 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-(2-aminoethyl)-1-[(1-phenyltetrazol-5-yl)methyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)C1CCCN(Cc2nnnn2-c2ccccc2)C1 |
| InChI | InChI=1S/C16H23N7O.ClH/c17-8-9-18-16(24)13-5-4-10-22(11-13)12-15-19-20-21-23(15)14-6-2-1-3-7-14;/h1-3,6-7,13H,4-5,8-12,17H2,(H,18,24);1H |
| InChIKey | RYUBNGJNMTYOMU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.87 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |