C15H19N7O2 — CID 97126070
(3R)-3-N-[(1-phenyltetrazol-5-yl)methyl]piperidine-1,3-dicarboxamide (PubChem CID 97126070) has the molecular formula C15H19N7O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is (3R)-3-N-[(1-phenyltetrazol-5-yl)methyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[(1-phenyltetrazol-5-yl)methyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 97126070 |
| Molecular Formula | C15H19N7O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (3R)-3-N-[(1-phenyltetrazol-5-yl)methyl]piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCC[C@@H](C(=O)NCc2nnnn2-c2ccccc2)C1 |
| InChI | InChI=1S/C15H19N7O2/c16-15(24)21-8-4-5-11(10-21)14(23)17-9-13-18-19-20-22(13)12-6-2-1-3-7-12/h1-3,6-7,11H,4-5,8-10H2,(H2,16,24)(H,17,23)/t11-/m1/s1 |
| InChIKey | KMANFWOYMRIGRB-LLVKDONJSA-N |
| XLogP | 0.07 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |