C14H16N4O2 — CID 60602109
(1-phenyltetrazol-5-yl)methyl cyclopentanecarboxylate (PubChem CID 60602109) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is (1-phenyltetrazol-5-yl)methyl cyclopentanecarboxylate.
| Compound Name | (1-phenyltetrazol-5-yl)methyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 60602109 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (1-phenyltetrazol-5-yl)methyl cyclopentanecarboxylate |
| SMILES | O=C(OCc1nnnn1-c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C14H16N4O2/c19-14(11-6-4-5-7-11)20-10-13-15-16-17-18(13)12-8-2-1-3-9-12/h1-3,8-9,11H,4-7,10H2 |
| InChIKey | SMUGPMNHISGOCK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |