C16H21N5O2 — CID 31314529
ethyl (3R)-1-[(1-phenyltetrazol-5-yl)methyl]piperidine-3-carboxylate (PubChem CID 31314529) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is ethyl (3R)-1-[(1-phenyltetrazol-5-yl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(1-phenyltetrazol-5-yl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 31314529 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | ethyl (3R)-1-[(1-phenyltetrazol-5-yl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(Cc2nnnn2-c2ccccc2)C1 |
| InChI | InChI=1S/C16H21N5O2/c1-2-23-16(22)13-7-6-10-20(11-13)12-15-17-18-19-21(15)14-8-4-3-5-9-14/h3-5,8-9,13H,2,6-7,10-12H2,1H3/t13-/m1/s1 |
| InChIKey | QLHSLDTYHHJQDU-CYBMUJFWSA-N |
| XLogP | 1.44 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |