C18H24N6O3 — CID 30936106
ethyl 4-oxo-4-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]butanoate (PubChem CID 30936106) has the molecular formula C18H24N6O3 and a molecular weight of 372.43 g/mol. Its IUPAC name is ethyl 4-oxo-4-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]butanoate.
| Compound Name | ethyl 4-oxo-4-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 30936106 |
| Molecular Formula | C18H24N6O3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | ethyl 4-oxo-4-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]butanoate |
| SMILES | CCOC(=O)CCC(=O)N1CCN(Cc2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C18H24N6O3/c1-2-27-18(26)9-8-17(25)23-12-10-22(11-13-23)14-16-19-20-21-24(16)15-6-4-3-5-7-15/h3-7H,2,8-14H2,1H3 |
| InChIKey | YCJYCWUAXPRQPR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |