C24H25N7O3 — CID 30937984
2-[3-[4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione (PubChem CID 30937984) has the molecular formula C24H25N7O3 and a molecular weight of 459.51 g/mol. Its IUPAC name is 2-[3-[4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 30937984 |
| Molecular Formula | C24H25N7O3 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-[3-[4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(-n2nnnc2CN2CCN(C(=O)CCN3C(=O)c4ccccc4C3=O)CC2)cc1 |
| InChI | InChI=1S/C24H25N7O3/c1-17-6-8-18(9-7-17)31-21(25-26-27-31)16-28-12-14-29(15-13-28)22(32)10-11-30-23(33)19-4-2-3-5-20(19)24(30)34/h2-9H,10-16H2,1H3 |
| InChIKey | NGYLKDCXBALOOL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 104.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|