C23H28N6O3 — CID 30937902
2-(4-ethoxyphenoxy)-1-[4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]ethanone (PubChem CID 30937902) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-1-[4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(4-ethoxyphenoxy)-1-[4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 30937902 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-1-[4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]ethanone |
| SMILES | CCOc1ccc(OCC(=O)N2CCN(Cc3nnnn3-c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H28N6O3/c1-3-31-20-8-10-21(11-9-20)32-17-23(30)28-14-12-27(13-15-28)16-22-24-25-26-29(22)19-6-4-18(2)5-7-19/h4-11H,3,12-17H2,1-2H3 |
| InChIKey | QZTOPIPNUDYWOR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |