C22H25FN6O2 — CID 30937243
2-(4-ethoxyphenyl)-1-[4-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]ethanone (PubChem CID 30937243) has the molecular formula C22H25FN6O2 and a molecular weight of 424.48 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1-[4-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(4-ethoxyphenyl)-1-[4-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 30937243 |
| Molecular Formula | C22H25FN6O2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1-[4-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]ethanone |
| SMILES | CCOc1ccc(CC(=O)N2CCN(Cc3nnnn3-c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H25FN6O2/c1-2-31-20-9-3-17(4-10-20)15-22(30)28-13-11-27(12-14-28)16-21-24-25-26-29(21)19-7-5-18(23)6-8-19/h3-10H,2,11-16H2,1H3 |
| InChIKey | BZLQBCVIDLRDHG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |