C16H19FN6O3 — CID 30937013
ethyl 2-[4-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2-oxoacetate (PubChem CID 30937013) has the molecular formula C16H19FN6O3 and a molecular weight of 362.37 g/mol. Its IUPAC name is ethyl 2-[4-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 30937013 |
| Molecular Formula | C16H19FN6O3 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | ethyl 2-[4-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CCN(Cc2nnnn2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H19FN6O3/c1-2-26-16(25)15(24)22-9-7-21(8-10-22)11-14-18-19-20-23(14)13-5-3-12(17)4-6-13/h3-6H,2,7-11H2,1H3 |
| InChIKey | VSZDYXYKDLCCAA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|