C16H18F2N6O3 — CID 30938052
ethyl 2-[4-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2-oxoacetate (PubChem CID 30938052) has the molecular formula C16H18F2N6O3 and a molecular weight of 380.36 g/mol. Its IUPAC name is ethyl 2-[4-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 30938052 |
| Molecular Formula | C16H18F2N6O3 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | ethyl 2-[4-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CCN(Cc2nnnn2-c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H18F2N6O3/c1-2-27-16(26)15(25)23-7-5-22(6-8-23)10-14-19-20-21-24(14)11-3-4-12(17)13(18)9-11/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | UQVRLBXLPILALZ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|