C27H28N6O2 — CID 30938779
[4-[[1-(4-ethoxyphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(4-phenylphenyl)methanone (PubChem CID 30938779) has the molecular formula C27H28N6O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is [4-[[1-(4-ethoxyphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(4-phenylphenyl)methanone.
| Compound Name | [4-[[1-(4-ethoxyphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 30938779 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | [4-[[1-(4-ethoxyphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(4-phenylphenyl)methanone |
| SMILES | CCOc1ccc(-n2nnnc2CN2CCN(C(=O)c3ccc(-c4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H28N6O2/c1-2-35-25-14-12-24(13-15-25)33-26(28-29-30-33)20-31-16-18-32(19-17-31)27(34)23-10-8-22(9-11-23)21-6-4-3-5-7-21/h3-15H,2,16-20H2,1H3 |
| InChIKey | QZJRIKHYRFDFON-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |