C17H23ClN6O — CID 30936482
1-[4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]pentan-1-one (PubChem CID 30936482) has the molecular formula C17H23ClN6O and a molecular weight of 362.87 g/mol. Its IUPAC name is 1-[4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]pentan-1-one.
| Compound Name | 1-[4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 30936482 |
| Molecular Formula | C17H23ClN6O |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-[4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCN(Cc2nnnn2-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H23ClN6O/c1-2-3-4-17(25)23-11-9-22(10-12-23)13-16-19-20-21-24(16)15-7-5-14(18)6-8-15/h5-8H,2-4,9-13H2,1H3 |
| InChIKey | ZCBQJKCMTPPNBX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |