C19H18ClFN6O — CID 30936606
[4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(2-fluorophenyl)methanone (PubChem CID 30936606) has the molecular formula C19H18ClFN6O and a molecular weight of 400.85 g/mol. Its IUPAC name is [4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 30936606 |
| Molecular Formula | C19H18ClFN6O |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1CCN(Cc2nnnn2-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H18ClFN6O/c20-14-5-7-15(8-6-14)27-18(22-23-24-27)13-25-9-11-26(12-10-25)19(28)16-3-1-2-4-17(16)21/h1-8H,9-13H2 |
| InChIKey | KTYKIEPMDVKDLA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |