C18H23ClN6O — CID 30936500
[4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-cyclopentylmethanone (PubChem CID 30936500) has the molecular formula C18H23ClN6O and a molecular weight of 374.88 g/mol. Its IUPAC name is [4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-cyclopentylmethanone.
| Compound Name | [4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 30936500 |
| Molecular Formula | C18H23ClN6O |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1CCN(Cc2nnnn2-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H23ClN6O/c19-15-5-7-16(8-6-15)25-17(20-21-22-25)13-23-9-11-24(12-10-23)18(26)14-3-1-2-4-14/h5-8,14H,1-4,9-13H2 |
| InChIKey | RNSFWOCVUHDSKE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |