C24H23ClN6O — CID 30857832
1-[4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2-naphthalen-1-ylethanone (PubChem CID 30857832) has the molecular formula C24H23ClN6O and a molecular weight of 446.94 g/mol. Its IUPAC name is 1-[4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2-naphthalen-1-ylethanone.
| Compound Name | 1-[4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2-naphthalen-1-ylethanone |
|---|---|
| PubChem CID | 30857832 |
| Molecular Formula | C24H23ClN6O |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-[4-[[1-(4-chlorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2-naphthalen-1-ylethanone |
| SMILES | O=C(Cc1cccc2ccccc12)N1CCN(Cc2nnnn2-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H23ClN6O/c25-20-8-10-21(11-9-20)31-23(26-27-28-31)17-29-12-14-30(15-13-29)24(32)16-19-6-3-5-18-4-1-2-7-22(18)19/h1-11H,12-17H2 |
| InChIKey | HOFCXZNGXNLSDQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |