C21H24N6O3 — CID 30936275
2-(3-methoxyphenoxy)-1-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]ethanone (PubChem CID 30936275) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-(3-methoxyphenoxy)-1-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(3-methoxyphenoxy)-1-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 30936275 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-(3-methoxyphenoxy)-1-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]ethanone |
| SMILES | COc1cccc(OCC(=O)N2CCN(Cc3nnnn3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H24N6O3/c1-29-18-8-5-9-19(14-18)30-16-21(28)26-12-10-25(11-13-26)15-20-22-23-24-27(20)17-6-3-2-4-7-17/h2-9,14H,10-13,15-16H2,1H3 |
| InChIKey | UTQGJKUXJFKJJR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |