C20H22FN7O2 — CID 29340361
4-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]-N-(3-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 29340361) has the molecular formula C20H22FN7O2 and a molecular weight of 411.44 g/mol. Its IUPAC name is 4-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]-N-(3-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]-N-(3-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 29340361 |
| Molecular Formula | C20H22FN7O2 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]-N-(3-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1cccc(NC(=O)N2CCN(Cc3nnnn3-c3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C20H22FN7O2/c1-30-18-7-3-5-16(13-18)22-20(29)27-10-8-26(9-11-27)14-19-23-24-25-28(19)17-6-2-4-15(21)12-17/h2-7,12-13H,8-11,14H2,1H3,(H,22,29) |
| InChIKey | QAWAWEYBKYJCJZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |