C18H25FN6O — CID 30937464
2-ethyl-1-[4-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]butan-1-one (PubChem CID 30937464) has the molecular formula C18H25FN6O and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-ethyl-1-[4-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]butan-1-one.
| Compound Name | 2-ethyl-1-[4-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 30937464 |
| Molecular Formula | C18H25FN6O |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 2-ethyl-1-[4-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]butan-1-one |
| SMILES | CCC(CC)C(=O)N1CCN(Cc2nnnn2-c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H25FN6O/c1-3-14(4-2)18(26)24-10-8-23(9-11-24)13-17-20-21-22-25(17)16-7-5-6-15(19)12-16/h5-7,12,14H,3-4,8-11,13H2,1-2H3 |
| InChIKey | PHLGXYPSNNIHLT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |