C23H29N7O5 — CID 29340627
4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]-N-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide (PubChem CID 29340627) has the molecular formula C23H29N7O5 and a molecular weight of 483.53 g/mol. Its IUPAC name is 4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]-N-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]-N-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 29340627 |
| Molecular Formula | C23H29N7O5 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]-N-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(-n2nnnc2CN2CCN(C(=O)Nc3cc(OC)c(OC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C23H29N7O5/c1-32-18-7-5-17(6-8-18)30-21(25-26-27-30)15-28-9-11-29(12-10-28)23(31)24-16-13-19(33-2)22(35-4)20(14-16)34-3/h5-8,13-14H,9-12,15H2,1-4H3,(H,24,31) |
| InChIKey | XDKYCAXIAVLWAS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'tetrazole_A(1)', 'substructure': 'N/A'} |
|---|