C25H30N6O4 — CID 30937883
(Z)-1-[4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 30937883) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is (Z)-1-[4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (Z)-1-[4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 30937883 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (Z)-1-[4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C\C(=O)N2CCN(Cc3nnnn3-c3ccc(C)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C25H30N6O4/c1-18-5-8-20(9-6-18)31-23(26-27-28-31)17-29-11-13-30(14-12-29)24(32)10-7-19-15-21(33-2)25(35-4)22(16-19)34-3/h5-10,15-16H,11-14,17H2,1-4H3/b10-7- |
| InChIKey | KACHWOSYOLCZNS-YFHOEESVSA-N |
| XLogP | 2.35 |
| TPSA | 94.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|