C18H21N5O4 — CID 102263409
3,4,5-trimethoxy-N-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]aniline (PubChem CID 102263409) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]aniline.
| Compound Name | 3,4,5-trimethoxy-N-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 102263409 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]aniline |
| SMILES | COc1ccc(-n2nnnc2CNc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H21N5O4/c1-24-14-7-5-13(6-8-14)23-17(20-21-22-23)11-19-12-9-15(25-2)18(27-4)16(10-12)26-3/h5-10,19H,11H2,1-4H3 |
| InChIKey | KSDYNOYDZMVUFC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'tetrazole_A(1)', 'substructure': 'N/A'} |
|---|