C11H13ClN4O3 — CID 43247247
5-(chloromethyl)-1-(3,4,5-trimethoxyphenyl)tetrazole (PubChem CID 43247247) has the molecular formula C11H13ClN4O3 and a molecular weight of 284.70 g/mol. Its IUPAC name is 5-(chloromethyl)-1-(3,4,5-trimethoxyphenyl)tetrazole.
| Compound Name | 5-(chloromethyl)-1-(3,4,5-trimethoxyphenyl)tetrazole |
|---|---|
| PubChem CID | 43247247 |
| Molecular Formula | C11H13ClN4O3 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 5-(chloromethyl)-1-(3,4,5-trimethoxyphenyl)tetrazole |
| SMILES | COc1cc(-n2nnnc2CCl)cc(OC)c1OC |
| InChI | InChI=1S/C11H13ClN4O3/c1-17-8-4-7(5-9(18-2)11(8)19-3)16-10(6-12)13-14-15-16/h4-5H,6H2,1-3H3 |
| InChIKey | RUQPLDLNIJCTGH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|