C17H16N6O7S — CID 90683163
5-[(3,5-dinitrophenyl)methylsulfanyl]-1-(3,4,5-trimethoxyphenyl)tetrazole (PubChem CID 90683163) has the molecular formula C17H16N6O7S and a molecular weight of 448.42 g/mol. Its IUPAC name is 5-[(3,5-dinitrophenyl)methylsulfanyl]-1-(3,4,5-trimethoxyphenyl)tetrazole.
| Compound Name | 5-[(3,5-dinitrophenyl)methylsulfanyl]-1-(3,4,5-trimethoxyphenyl)tetrazole |
|---|---|
| PubChem CID | 90683163 |
| Molecular Formula | C17H16N6O7S |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 5-[(3,5-dinitrophenyl)methylsulfanyl]-1-(3,4,5-trimethoxyphenyl)tetrazole |
| SMILES | COc1cc(-n2nnnc2SCc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H16N6O7S/c1-28-14-7-11(8-15(29-2)16(14)30-3)21-17(18-19-20-21)31-9-10-4-12(22(24)25)6-13(5-10)23(26)27/h4-8H,9H2,1-3H3 |
| InChIKey | BIHJWWXVDADLKF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 157.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|