C16H15N5O2S — CID 26650844
1-(3,4-dimethylphenyl)-5-[(3-nitrophenyl)methylsulfanyl]tetrazole (PubChem CID 26650844) has the molecular formula C16H15N5O2S and a molecular weight of 341.40 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-5-[(3-nitrophenyl)methylsulfanyl]tetrazole.
| Compound Name | 1-(3,4-dimethylphenyl)-5-[(3-nitrophenyl)methylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 26650844 |
| Molecular Formula | C16H15N5O2S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-5-[(3-nitrophenyl)methylsulfanyl]tetrazole |
| SMILES | Cc1ccc(-n2nnnc2SCc2cccc([N+](=O)[O-])c2)cc1C |
| InChI | InChI=1S/C16H15N5O2S/c1-11-6-7-14(8-12(11)2)20-16(17-18-19-20)24-10-13-4-3-5-15(9-13)21(22)23/h3-9H,10H2,1-2H3 |
| InChIKey | VBZQWBIIHXXEAC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|