About 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide
3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide (PubChem CID 47068537) has the molecular formula C19H21N5OS
and a molecular weight of 367.48 g/mol. Its IUPAC name is 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide |
| PubChem CID | 47068537 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide |
| SMILES | Cc1ccc(-n2nnnc2SCc2cccc(C(=O)N(C)C)c2)cc1C |
| InChI | InChI=1S/C19H21N5OS/c1-13-8-9-17(10-14(13)2)24-19(20-21-22-24)26-12-15-6-5-7-16(11-15)18(25)23(3)4/h5-11H,12H2,1-4H3 |
| InChIKey | VMUSOCKTOHARAB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide?
The IUPAC name of 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide (CID 47068537) is 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide.
What is the SMILES notation for 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide?
The canonical SMILES for 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide is Cc1ccc(-n2nnnc2SCc2cccc(C(=O)N(C)C)c2)cc1C.
What is the InChIKey of 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide?
The InChIKey is VMUSOCKTOHARAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5OS/c1-13-8-9-17(10-14(13)2)24-19(20-21-22-24)26-12-15-6-5-7-16(11-15)18(25)23(3)4/h5-11H,12H2,1-4H3.
What are the key properties of 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide?
3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide has a molecular weight of 367.48 g/mol, XLogP of 3.27, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-N,N-dimethylbenzamide is sourced from PubChem (CID 47068537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).