C15H14ClN5S — CID 33453638
2-chloro-5-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]pyridine (PubChem CID 33453638) has the molecular formula C15H14ClN5S and a molecular weight of 331.83 g/mol. Its IUPAC name is 2-chloro-5-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]pyridine.
| Compound Name | 2-chloro-5-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 33453638 |
| Molecular Formula | C15H14ClN5S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-chloro-5-[[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]pyridine |
| SMILES | Cc1ccc(-n2nnnc2SCc2ccc(Cl)nc2)cc1C |
| InChI | InChI=1S/C15H14ClN5S/c1-10-3-5-13(7-11(10)2)21-15(18-19-20-21)22-9-12-4-6-14(16)17-8-12/h3-8H,9H2,1-2H3 |
| InChIKey | OIDNPTZFKJVFRR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|