C18H14N6O2S — CID 8977031
(Z)-3-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-3-(3-nitrophenyl)prop-2-enenitrile (PubChem CID 8977031) has the molecular formula C18H14N6O2S and a molecular weight of 378.42 g/mol. Its IUPAC name is (Z)-3-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-3-(3-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-3-(3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8977031 |
| Molecular Formula | C18H14N6O2S |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (Z)-3-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-3-(3-nitrophenyl)prop-2-enenitrile |
| SMILES | Cc1ccc(-n2nnnc2S/C(=C\C#N)c2cccc([N+](=O)[O-])c2)cc1C |
| InChI | InChI=1S/C18H14N6O2S/c1-12-6-7-15(10-13(12)2)23-18(20-21-22-23)27-17(8-9-19)14-4-3-5-16(11-14)24(25)26/h3-8,10-11H,1-2H3/b17-8- |
| InChIKey | SSMNLKLFTRPEOY-IUXPMGMMSA-N |
| XLogP | 3.84 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|