C19H18N6O4S — CID 86964738
3-[3-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylpropyl]-5-nitro-1,3-benzoxazol-2-one (PubChem CID 86964738) has the molecular formula C19H18N6O4S and a molecular weight of 426.46 g/mol. Its IUPAC name is 3-[3-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylpropyl]-5-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[3-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylpropyl]-5-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 86964738 |
| Molecular Formula | C19H18N6O4S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 3-[3-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylpropyl]-5-nitro-1,3-benzoxazol-2-one |
| SMILES | Cc1ccc(-n2nnnc2SCCCn2c(=O)oc3ccc([N+](=O)[O-])cc32)cc1C |
| InChI | InChI=1S/C19H18N6O4S/c1-12-4-5-14(10-13(12)2)24-18(20-21-22-24)30-9-3-8-23-16-11-15(25(27)28)6-7-17(16)29-19(23)26/h4-7,10-11H,3,8-9H2,1-2H3 |
| InChIKey | BYPDPBFBQCKSFK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 121.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|