C18H21N5O4S2 — CID 86964702
3-[3-[[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]-5-nitro-1,3-benzoxazol-2-one (PubChem CID 86964702) has the molecular formula C18H21N5O4S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 3-[3-[[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]-5-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[3-[[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]-5-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 86964702 |
| Molecular Formula | C18H21N5O4S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 3-[3-[[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]-5-nitro-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccc([N+](=O)[O-])cc2n1CCCSc1nnc(NC2CCCCC2)s1 |
| InChI | InChI=1S/C18H21N5O4S2/c24-18-22(14-11-13(23(25)26)7-8-15(14)27-18)9-4-10-28-17-21-20-16(29-17)19-12-5-2-1-3-6-12/h7-8,11-12H,1-6,9-10H2,(H,19,20) |
| InChIKey | RYCDEBHAXLULDY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|