C16H13FN2O5 — CID 39049192
3-[3-(4-fluorophenoxy)propyl]-5-nitro-1,3-benzoxazol-2-one (PubChem CID 39049192) has the molecular formula C16H13FN2O5 and a molecular weight of 332.29 g/mol. Its IUPAC name is 3-[3-(4-fluorophenoxy)propyl]-5-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[3-(4-fluorophenoxy)propyl]-5-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 39049192 |
| Molecular Formula | C16H13FN2O5 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-[3-(4-fluorophenoxy)propyl]-5-nitro-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccc([N+](=O)[O-])cc2n1CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN2O5/c17-11-2-5-13(6-3-11)23-9-1-8-18-14-10-12(19(21)22)4-7-15(14)24-16(18)20/h2-7,10H,1,8-9H2 |
| InChIKey | OGOXHBPBUURNNT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|