C11H10N2O5 — CID 62040396
5-nitro-3-(2-oxobutyl)-1,3-benzoxazol-2-one (PubChem CID 62040396) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 5-nitro-3-(2-oxobutyl)-1,3-benzoxazol-2-one.
| Compound Name | 5-nitro-3-(2-oxobutyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 62040396 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-nitro-3-(2-oxobutyl)-1,3-benzoxazol-2-one |
| SMILES | CCC(=O)Cn1c(=O)oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C11H10N2O5/c1-2-8(14)6-12-9-5-7(13(16)17)3-4-10(9)18-11(12)15/h3-5H,2,6H2,1H3 |
| InChIKey | LWQLAFKAKMRSON-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|