C9H8N4O5 — CID 63578672
2-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)acetohydrazide (PubChem CID 63578672) has the molecular formula C9H8N4O5 and a molecular weight of 252.19 g/mol. Its IUPAC name is 2-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)acetohydrazide.
| Compound Name | 2-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 63578672 |
| Molecular Formula | C9H8N4O5 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)acetohydrazide |
| SMILES | NNC(=O)Cn1c(=O)oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C9H8N4O5/c10-11-8(14)4-12-6-3-5(13(16)17)1-2-7(6)18-9(12)15/h1-3H,4,10H2,(H,11,14) |
| InChIKey | RQCGELMIRMPSJW-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|