C17H12N4O8 — CID 86964767
5-nitro-3-[3-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)propyl]-1,3-benzoxazol-2-one (PubChem CID 86964767) has the molecular formula C17H12N4O8 and a molecular weight of 400.30 g/mol. Its IUPAC name is 5-nitro-3-[3-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)propyl]-1,3-benzoxazol-2-one.
| Compound Name | 5-nitro-3-[3-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)propyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 86964767 |
| Molecular Formula | C17H12N4O8 |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 5-nitro-3-[3-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)propyl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccc([N+](=O)[O-])cc2n1CCCn1c(=O)oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H12N4O8/c22-16-18(12-8-10(20(24)25)2-4-14(12)28-16)6-1-7-19-13-9-11(21(26)27)3-5-15(13)29-17(19)23/h2-5,8-9H,1,6-7H2 |
| InChIKey | VJIXMZRTXHDXMW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 156.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|