C10H7N3O4 — CID 3125020
3-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)propanenitrile (PubChem CID 3125020) has the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. Its IUPAC name is 3-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)propanenitrile.
| Compound Name | 3-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)propanenitrile |
|---|---|
| PubChem CID | 3125020 |
| Molecular Formula | C10H7N3O4 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 3-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)propanenitrile |
| SMILES | N#CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C10H7N3O4/c11-4-1-5-12-8-3-2-7(13(15)16)6-9(8)17-10(12)14/h2-3,6H,1,5H2 |
| InChIKey | MPYIOSLLVFLXPZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 102.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|